Welcome to Entry Card of Peptide
Details of SAPdb ID 1884 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1884 | |
| PMID | 27778498 | |
| Year | 2016 | |
| Name | H-Phe-Phe-NH2 .hydrochloride | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NH2 and HCl | |
| Technique | TEM, SEM | |
| Solvent | phosphate buffer saline (PBS) | |
| Method | Cary-Eclipse spectrofluorophotometer | |
| Concentration | 0.5 % (w/v) | |
| pH | 7.4 | |
| Temperature | 37 °C | |
| Incubation Period | 12 h, 24 h or 5 days | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |