Welcome to Entry Card of Peptide
Details of SAPdb ID 1879 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1879 | |
| PMID | 27722469 | |
| Year | 2016 | |
| Name | Fmoc-AA-OH | |
| Sequence | AA | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | Fmoc and OH | |
| Technique | FTIR, CD, fluorescence | |
| Solvent | NA | |
| Method | dynamic peptide library (DPL) approach | |
| Concentration | NA | |
| pH | NA | |
| Temperature | 0 to 298K | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O | |