Details of SAPdb ID 1870 |
Primary information | ||
---|---|---|
SAPdb_ID | 1870 | |
PMID | 27696352 | |
Year | 2016 | |
Name | Fmoc-PhePhe (Compound 1) | |
Sequence | FF | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | Fmoc (N-fluorenylmethoxycarbonyl diphenylalanine) | |
Technique | Circular dichroism spectroscopy, FT-IR spectroscopy, NMR spectroscopy, TEM, HPLC, PAD-X and Rheology | |
Solvent | glucono-d-lactone (GdL) | |
Method | Gelation conditions using GdL | |
Concentration | 18 mM | |
pH | 7.1–7.6 | |
Temperature | 60 °C | |
Incubation Period | 12 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogels | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |