Welcome to Entry Card of Peptide
Details of SAPdb ID 1870 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1870 | |
| PMID | 27696352 | |
| Year | 2016 | |
| Name | Fmoc-PhePhe (Compound 1) | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | Fmoc (N-fluorenylmethoxycarbonyl diphenylalanine) | |
| Technique | Circular dichroism spectroscopy, FT-IR spectroscopy, NMR spectroscopy, TEM, HPLC, PAD-X and Rheology | |
| Solvent | glucono-d-lactone (GdL) | |
| Method | Gelation conditions using GdL | |
| Concentration | 18 mM | |
| pH | 7.1–7.6 | |
| Temperature | 60 °C | |
| Incubation Period | 12 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogels | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |