Details of SAPdb ID 1860 |
Primary information | ||
---|---|---|
SAPdb_ID | 1860 | |
PMID | 27582363 | |
Year | 2016 | |
Name | FDFD | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | buffer (2% glutaraldehyde and 2% paraformaldehyde in 0.1 M sodium cacodylate) | |
Method | NA | |
Concentration | 0.1 M | |
pH | 7.4 | |
Temperature | 4 °C | |
Incubation Period | half an hour | |
Self-Assembly Formation | No | |
Type of Self-Assembly | NA | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | NA | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |