Welcome to Entry Card of Peptide
Details of SAPdb ID 1843 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1843 | |
| PMID | 27508285 | |
| Year | 2016 | |
| Name | Ac-L-Phe-L-Phe-L-Ala-NH2 | |
| Sequence | FFA | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | Transmission Electron Microscopy (TEM) | |
| Solvent | NA | |
| Method | NA | |
| Concentration | 0.7% w/v | |
| pH | 6.12 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanostructures and hydrogels | |
| Size of Self-Assembled structure | 50–500 nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | high stability | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C)C(=O)O | |