Details of SAPdb ID 1834 |
Primary information | ||
---|---|---|
SAPdb_ID | 1834 | |
PMID | 27385634 | |
Year | 2016 | |
Name | NI-GFF | |
Sequence | GFF | |
N-Terminal Modification | NI | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Conjugate | |
Conjugate Partner | NI (1,8- Naphthalimide) | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Purified water | |
Method | NA | |
Concentration | 0.5 wt% | |
pH | 4.0-10.0 at 1 wt% | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanostructure and Hydrogel | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |