Details of SAPdb ID 1832 |
Primary information | ||
---|---|---|
SAPdb_ID | 1832 | |
PMID | 27207058 | |
Year | 2016 | |
Name | FmocFF-Alg2 | |
Sequence | FF | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Alginate | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Mixture | |
Conjugate Partner | Fmoc and Alginate | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | alginate + CaCl2 solution | |
Method | NA | |
Concentration | 0.25% (w/v) | |
pH | 10.5 with 0.1 M NaOH | |
Temperature | 37 °C | |
Incubation Period | 6 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogels | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Higher stability | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |