Welcome to Entry Card of Peptide
Details of SAPdb ID 1831 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1831 | |
| PMID | 27207058 | |
| Year | 2016 | |
| Name | FmocFF-Alg1 | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | Alginate | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Mixture | |
| Conjugate Partner | Fmoc and Alginate | |
| Technique | Scanning Electron Microscopy (SEM) | |
| Solvent | alginate + CaCl2 solution | |
| Method | NA | |
| Concentration | 0.1% (w/v) | |
| pH | 10.5 with 0.1 M NaOH | |
| Temperature | 37 °C | |
| Incubation Period | 5 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogels | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Higher stability | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |