Details of SAPdb ID 1827 |
Primary information | ||
---|---|---|
SAPdb_ID | 1827 | |
PMID | 27098442 | |
Year | 2016 | |
Name | H-His-D-Leu-D-Asp-OH (peptide 1i) | |
Sequence | HLD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Circular dichroism (CD) | |
Solvent | organic solvents or biphasic solvent | |
Method | NA | |
Concentration | 0.10% | |
pH | 11 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC1=CN=C-N1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O |