Welcome to Entry Card of Peptide
Details of SAPdb ID 1820 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1820 | |
| PMID | 27098442 | |
| Year | 2016 | |
| Name | H-D-Asp-D-Leu-His-NH2 (peptide 1b) | |
| Sequence | DLH | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | Circular dichroism (CD) | |
| Solvent | organic solvents or biphasic solvent | |
| Method | NA | |
| Concentration | 0.10% | |
| pH | 11 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |