Welcome to Entry Card of Peptide
Details of SAPdb ID 1808 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1808 | |
| PMID | 30892363 | |
| Year | 2019 | |
| Name | oligopeptide | |
| Sequence | FL | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | NA | |
| Solvent | sodium pHospHate buffer | |
| Method | NA | |
| Concentration | 10mM | |
| pH | 7 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | supramolecular complexes | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |