Welcome to Entry Card of Peptide
Details of SAPdb ID 1797 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1797 | |
| PMID | 30758022 | |
| Year | 2019 | |
| Name | diPhenylalanine peptide | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | conjugated | |
| Conjugate Partner | Rhein (4,5-dihydroxyanthraquinone-2-carboxylic acid) | |
| Technique | Transmission electron microscopy (TEM), PLM | |
| Solvent | NA | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoassemblies | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | intramolecular π−π stacking | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |