Welcome to Entry Card of Peptide
Details of SAPdb ID 1796 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1796 | |
| PMID | 30691142 | |
| Year | 2019 | |
| Name | D-Leu-Phe-Phe | |
| Sequence | LFF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | FT-IR, TEM, CD | |
| Solvent | buffer solutions | |
| Method | NA | |
| Concentration | 10 mM | |
| pH | 7.3± 0.1 | |
| Temperature | Room temperature | |
| Incubation Period | 30min | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |