Details of SAPdb ID 1783 |
Primary information | ||
---|---|---|
SAPdb_ID | 1783 | |
PMID | 30348428 | |
Year | 2019 | |
Name | DL-Ala-DL-Phe | |
Sequence | AF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | NA | |
Solvent | NA | |
Method | NA | |
Concentration | NA | |
pH | 7.6 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanotubes | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |