Welcome to Entry Card of Peptide
Details of SAPdb ID 1779 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1779 | |
| PMID | 31211520 | |
| Year | 2019 | |
| Name | tyroserleutide | |
| Sequence | YSL | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | conjugated | |
| Conjugate Partner | AMP-NPs | |
| Technique | Transmission Electron Microscopy (TEM) | |
| Solvent | uranium acetate solution | |
| Method | NA | |
| Concentration | 0.5% (w/v) | |
| pH | 7.4 | |
| Temperature | NA | |
| Incubation Period | 10 s | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | 20–150 nm | |
| Linear/Cyclic | Cyclic | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |