Welcome to Entry Card of Peptide
Details of SAPdb ID 1778 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1778 | |
| PMID | 31181152 | |
| Year | 2019 | |
| Name | Fmoc-FF | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | CD spectra, TEM, FTIR spectra | |
| Solvent | double-distilled water containing different concentrations of metal ions (NaCl, KCl, ZnCl2, CuCl2, FeCl3, AlCl3) | |
| Method | NA | |
| Concentration | 2.0 mg/mL | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofiber | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |