Welcome to Entry Card of Peptide
Details of SAPdb ID 1777 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1777 | |
| PMID | 31179471 | |
| Year | 2019 | |
| Name | Fmoc-FF | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | Polarized optical microscope (POM), AFM, SEM | |
| Solvent | spermidine | |
| Method | NA | |
| Concentration | 20 mM, | |
| pH | 8.5 | |
| Temperature | 20°C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofilaments | |
| Size of Self-Assembled structure | ~3 nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |