Details of SAPdb ID 1777 |
Primary information | ||
---|---|---|
SAPdb_ID | 1777 | |
PMID | 31179471 | |
Year | 2019 | |
Name | Fmoc-FF | |
Sequence | FF | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | Polarized optical microscope (POM), AFM, SEM | |
Solvent | spermidine | |
Method | NA | |
Concentration | 20 mM, | |
pH | 8.5 | |
Temperature | 20°C | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofilaments | |
Size of Self-Assembled structure | ~3 nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |