Welcome to Entry Card of Peptide
Details of SAPdb ID 1766 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1766 | |
| PMID | 30968092 | |
| Year | 2019 | |
| Name | LPhe-L-Phe-D-Phe | |
| Sequence | FFf | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | SEM, TG, VCD, and solid-state NMR | |
| Solvent | HFIP | |
| Method | NA | |
| Concentration | 10 μL | |
| pH | 4.9-5.2 | |
| Temperature | 251℃ | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Cyclic | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |