Details of SAPdb ID 1763 |
Primary information | ||
---|---|---|
SAPdb_ID | 1763 | |
PMID | 30968092 | |
Year | 2019 | |
Name | L-Phe-L-Phe-L-Phe | |
Sequence | FFF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | SEM, TG, VCD, and solid-state NMR | |
Solvent | HFIP | |
Method | NA | |
Concentration | 10 μL | |
pH | 4.9-5.2 | |
Temperature | 230℃ | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanostructures | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |