Welcome to Entry Card of Peptide
Details of SAPdb ID 1755 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1755 | |
| PMID | 30921499 | |
| Year | 2019 | |
| Name | (p-aminobenzoyl)-L-Phe-D-Ala-L-Phe-NH2 | |
| Sequence | FAF | |
| N-Terminal Modification | (p-aminobenzoyl) | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | TEM, EDX, Raman, rheometry, UV-Vis, NMR and circular dichroism | |
| Solvent | CH3CN | |
| Method | NA | |
| Concentration | 5 mM | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanostructure | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Cyclic | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |