Welcome to Entry Card of Peptide
Details of SAPdb ID 1754 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1754 | |
| PMID | 30920525 | |
| Year | 2017 | |
| Name | DLeu-Phe-Phe | |
| Sequence | LFF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | Fourier-transformed infrared (FT-IR), circular dichroism, Thioflavin T fluorescence, transmission electron microscopy (TEM), and oscillatory rheometry | |
| Solvent | sodium pHospHate buffer | |
| Method | NA | |
| Concentration | 10 mM | |
| pH | 7.2± 0.1 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |