Welcome to Entry Card of Peptide
Details of SAPdb ID 1742 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1742 | |
| PMID | 30778487 | |
| Year | 2019 | |
| Name | DOPA-Phe(4F)-Phe(4F)-OMe | |
| Sequence | FF | |
| N-Terminal Modification | DOPA | |
| C-Terminal Modification | Methoxy | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | Scanning Electron Microscopy (SEM) | |
| Solvent | HCl or Tris buffer | |
| Method | NA | |
| Concentration | 1M or 10 mM | |
| pH | 1 or 8.5 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | No | |
| Type of Self-Assembly | NA | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |