Details of SAPdb ID 1726 |
Primary information | ||
---|---|---|
SAPdb_ID | 1726 | |
PMID | 30452865 | |
Year | 2018 | |
Name | Fmoc-FWR | |
Sequence | FWR | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | Scanning electron microscopy (SEM), atomic force microscopy (AFM) and transmission electron microscopy (TEM) | |
Solvent | NA | |
Method | NA | |
Concentration | 2 mM | |
pH | 6 | |
Temperature | Room temperature | |
Incubation Period | 25 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofibril | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O |