Details of SAPdb ID 1713 |
Primary information | ||
---|---|---|
SAPdb_ID | 1713 | |
PMID | 30307451 | |
Year | 2018 | |
Name | Fmoc-LG | |
Sequence | LG | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | UV-vis spectroscopy and BAM | |
Solvent | bulk water solution | |
Method | NA | |
Concentration | NA | |
pH | 7 | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanostructures | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O |