Welcome to Entry Card of Peptide
Details of SAPdb ID 1709 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1709 | |
| PMID | 30280722 | |
| Year | 2018 | |
| Name | GlyAsp | |
| Sequence | GD | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | light scattering, NMR, IR, and TEM | |
| Solvent | 470 nm in aqueous buffered solution | |
| Method | The development of a fluorescent method for the selective ratiometric detection of Al3+ ions in pure aqueous solutions | |
| Concentration | 10 mM Tris | |
| pH | 5 to 7.4 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |