Welcome to Entry Card of Peptide
Details of SAPdb ID 1708 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1708 | |
| PMID | 30270398 | |
| Year | 2018 | |
| Name | diPhenylalanine (FF) | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | Microfluidic | |
| Solvent | acetic acid | |
| Method | The self-assembly of peptide and protein molecules into nanoscale filaments is a process associated with both biological function and malfunction. | |
| Concentration | 150 mg/mL | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Unstable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |