Details of SAPdb ID 1686 |
Primary information | ||
---|---|---|
SAPdb_ID | 1686 | |
PMID | 29933690 | |
Year | 2018 | |
Name | cyclic dipeptides (CDPs) | |
Sequence | SS | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | SEM and TEM | |
Solvent | chloroform and methanol | |
Method | NA | |
Concentration | 100 mmolâ‹…L-1 | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanotubes | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)O |