Details of SAPdb ID 1683 |
Primary information | ||
---|---|---|
SAPdb_ID | 1683 | |
PMID | 29906562 | |
Year | 2018 | |
Name | dipeptidyl peptidase-4 | |
Sequence | SAX | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | conjugate | |
Conjugate Partner | chitosan-L-valine | |
Technique | FTIR, powder X-ray diffraction (P-XRD) and scanning electron microscopy (SEM) | |
Solvent | N-Hydroxysuccinimide (NHS), 1-Ethyl-3-(3- dimethylaminopropyl)carbodiimide (EDC) and Boc-L-valine | |
Method | NA | |
Concentration | 1 mL of 50:50 (v:v) | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 30 days | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)O |