Details of SAPdb ID 1664 |
Primary information | ||
---|---|---|
SAPdb_ID | 1664 | |
PMID | 29696249 | |
Year | 2018 | |
Name | cationic glycylalanylglycine (GAG) | |
Sequence | GAG | |
N-Terminal Modification | NH+ 3 group | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | IR and vibrational circular dichroism(VCD) spectra | |
Solvent | Ethanol pHarmco- Aaper/45 deionized water | |
Method | NA | |
Concentration | 0.025, 0.05, 0.1, 0.5, or 1.0 lg/m | |
pH | 2 | |
Temperature | 10 and 23°C | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogel | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | NCC(=O)N[C@@]([H])(C)C(=O)NCC(=O)O |