Welcome to Entry Card of Peptide
Details of SAPdb ID 1664 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1664 | |
| PMID | 29696249 | |
| Year | 2018 | |
| Name | cationic glycylalanylglycine (GAG) | |
| Sequence | GAG | |
| N-Terminal Modification | NH+ 3 group | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | IR and vibrational circular dichroism(VCD) spectra | |
| Solvent | Ethanol pHarmco- Aaper/45 deionized water | |
| Method | NA | |
| Concentration | 0.025, 0.05, 0.1, 0.5, or 1.0 lg/m | |
| pH | 2 | |
| Temperature | 10 and 23°C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(C)C(=O)NCC(=O)O | |