Details of SAPdb ID 1658 |
Primary information | ||
---|---|---|
SAPdb_ID | 1658 | |
PMID | 29537820 | |
Year | 2018 | |
Name | diPhenylalanine | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | taurine group (2-aminoethanesulfonic acid) | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | LD-1-SO3, DL-1-SO3, and DD-1-SO3 | |
Method | NA | |
Concentration | NA | |
pH | 7.4 | |
Temperature | Room temperature | |
Incubation Period | 30s | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofiber | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |