Details of SAPdb ID 1655 |
Primary information | ||
---|---|---|
SAPdb_ID | 1655 | |
PMID | 29491707 | |
Year | 2018 | |
Name | chitosan-glutathione-glycylsarcosine | |
Sequence | GS | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | conjugate | |
Conjugate Partner | CTS-Fmoc-GS | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | 15 mL of dioxane and 10 mL of purified water | |
Method | The synthesis of Fmoc-GS was performed as follows: GS (1.0 g, 6.84 mmol) was dissolved in 15 mL of dioxane and 10 mL of purified water, treated with anhydrous sodium bicarbonate (1.15 g, 13.68 mmol) and stirred to form a clear solution at room temperature | |
Concentration | NA | |
pH | 5 | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | NCC(=O)N[C@@]([H])(CO)C(=O)O |