Welcome to Entry Card of Peptide
Details of SAPdb ID 1654 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1654 | |
| PMID | 29435526 | |
| Year | 2018 | |
| Name | dipeptide-fluoropHores | |
| Sequence | AA | |
| N-Terminal Modification | (TGM-83) | |
| C-Terminal Modification | (TGM-82) | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | conjugate | |
| Conjugate Partner | TGM-82 and TGM-83 | |
| Technique | fluorescent optical microscopy | |
| Solvent | 1:1 molar ratio of TGM-82 and TGM-83 | |
| Method | NA | |
| Concentration | NA | |
| pH | 7.4 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofibril | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | hydrogen bonding, ionic (among carboxylate and ammonium terminals) and aromatic π-π interactions. | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O | |