Welcome to Entry Card of Peptide
Details of SAPdb ID 1649 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1649 | |
| PMID | 29379926 | |
| Year | 2018 | |
| Name | Phe-Phe motif | |
| Sequence | FF | |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | conjugate | |
| Conjugate Partner | Boc-pHe-pHe | |
| Technique | SEM, HRTEM, AFM | |
| Solvent | 1,1,1,3,3,3-hexafluoro-2- propanol (HFIP), lyopHilized | |
| Method | NA | |
| Concentration | 3mg/ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanovasicles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |