Details of SAPdb ID 1649 |
Primary information | ||
---|---|---|
SAPdb_ID | 1649 | |
PMID | 29379926 | |
Year | 2018 | |
Name | Phe-Phe motif | |
Sequence | FF | |
N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | conjugate | |
Conjugate Partner | Boc-pHe-pHe | |
Technique | SEM, HRTEM, AFM | |
Solvent | 1,1,1,3,3,3-hexafluoro-2- propanol (HFIP), lyopHilized | |
Method | NA | |
Concentration | 3mg/ml | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanovasicles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |