Welcome to Entry Card of Peptide
Details of SAPdb ID 1648 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1648 | |
| PMID | 29372986 | |
| Year | 2017 | |
| Name | âº,β-dehydroPhenylalanine | |
| Sequence | R-Delta-F | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | Delta-F or Δphe=alpha-beta-dehydrophenylalanine | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | Transmission Electron microscopy (TEM) | |
| Solvent | 1,1,1,3,3,3- hexa-fluoro-isopropanol (HFIP) | |
| Method | NA | |
| Concentration | 1 mg mL−1 | |
| pH | 3–10.5 | |
| Temperature | 37°C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | 250-275 nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |