Details of SAPdb ID 1645 |
Primary information | ||
---|---|---|
SAPdb_ID | 1645 | |
PMID | 29337528 | |
Year | 2018 | |
Name | diPhenylalanine | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | SEM and TEM | |
Solvent | HFP (1,1,1,3,3,3-hexafluor-2-propanol) and water | |
Method | procedures for controlled assembly, as well as disassembly of the dipeptide dipHenylalanine (FF) into aligned and ultralong single crystals in a capillary | |
Concentration | NA | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofibers | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |