Details of SAPdb ID 1644 |
Primary information | ||
---|---|---|
SAPdb_ID | 1644 | |
PMID | 29303206 | |
Year | 2018 | |
Name | Fluorenylmethoxycarbonyl-diPhenylalanine | |
Sequence | FF | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | NMR spectroscopy | |
Solvent | DMSO/H2O (xH2O = 0.95), methanol/H2O (xH2O = 0.95 and xH2O = 0.20), pure methanol (no H2O), and pure toluene. | |
Method | NA | |
Concentration | (110 μL /40 μL) | |
pH | NA | |
Temperature | 75 °C | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofibers | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Metastable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |