Welcome to Entry Card of Peptide
Details of SAPdb ID 1644 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1644 | |
| PMID | 29303206 | |
| Year | 2018 | |
| Name | Fluorenylmethoxycarbonyl-diPhenylalanine | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | NMR spectroscopy | |
| Solvent | DMSO/H2O (xH2O = 0.95), methanol/H2O (xH2O = 0.95 and xH2O = 0.20), pure methanol (no H2O), and pure toluene. | |
| Method | NA | |
| Concentration | (110 μL /40 μL) | |
| pH | NA | |
| Temperature | 75 °C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofibers | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Metastable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |