Details of SAPdb ID 1643 |
Primary information | ||
---|---|---|
SAPdb_ID | 1643 | |
PMID | 29289731 | |
Year | 2017 | |
Name | 4-[(3-Formyl-4- hydroxy)Phenylazo]benzene (FHPAB)) | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | conjugate | |
Conjugate Partner | FF-HFPAB | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | 1,1,1,3,3,3-hexafluoro-2-isopropanol | |
Method | FF-based 2D pattern using formyl azobenzene (4-[(3- Formyl-4-hydroxy)pHenylazo]benzene (FHPAB)) to manipulate the self-assembly of FF | |
Concentration | HFP/water | |
pH | NA | |
Temperature | 50 °C | |
Incubation Period | 30 min | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | micro/nano | |
Size of Self-Assembled structure | 8.8 μm. | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |