Details of SAPdb ID 1642 |
Primary information | ||
---|---|---|
SAPdb_ID | 1642 | |
PMID | 29285927 | |
Year | 2017 | |
Name | crystalline dipeptide nanobelts | |
Sequence | FF | |
N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | peptide | |
Conjugate Partner | None | |
Technique | SEM, AFM, TEM | |
Solvent | Tris-HCl | |
Method | NA | |
Concentration | 15 mg/mL | |
pH | 7.5 | |
Temperature | NA | |
Incubation Period | 30 s, 1 min,3 min, 5 min, 10 min | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanofiber | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Metastable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |