Details of SAPdb ID 1613 |
Primary information | ||
---|---|---|
SAPdb_ID | 1613 | |
PMID | 22534735 | |
Year | 2012 | |
Name | FF | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) and AFM (Atomic Force Microscopy) | |
Solvent | Water | |
Method | Peptide was dissolved in water at a concentration of 2 mg/ml. this solution was then incubated for 2 h at 37 °C. | |
Concentration | 2mg/ml | |
pH | 6.5 | |
Temperature | 37 °C | |
Incubation Period | Yes | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Fibrillar structure | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |