Details of SAPdb ID 1609 |
Primary information | ||
---|---|---|
SAPdb_ID | 1609 | |
PMID | 21085503 | |
Year | 2010 | |
Name | (S,R)-bis(LeuLeu) or 1a | |
Sequence | LL | |
N-Terminal Modification | Free | |
C-Terminal Modification | Methyaltion | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Toluene | |
Method | 10 mg peptide placed in a test tube, and the solvent was added by microsyringe in 100-500 µL portions. After each addition the mixture was gently heated until the substance dissolved, and was then allowed to cool spontaneously to room temperature and formation of gel. checked by test tube inversion. | |
Concentration | NA | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | Yes | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Tapes | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N(C)[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C=O |