Details of SAPdb ID 1570 |
Primary information | ||
---|---|---|
SAPdb_ID | 1570 | |
PMID | 21948432 | |
Year | 2011 | |
Name | 3G | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Conjugate (Nucleopeptide) | |
Conjugate Partner | Nucleobase | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Water | |
Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 7.4 | |
Concentration | 2 %wt | |
pH | 7.4 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydogel (consists of fibers) | |
Size of Self-Assembled structure | Width : 14nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |