Details of SAPdb ID 1561 |
Primary information | ||
---|---|---|
SAPdb_ID | 1561 | |
PMID | 21879773 | |
Year | 2011 | |
Name | Phe-Phe | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | Ethanol | |
Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, AAO surface and dried at ambient temperature until the solvent evaporated. | |
Concentration | 2 mg/ml | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Tubular and ribbon like morphology | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |