Details of SAPdb ID 1537 |
Primary information | ||
---|---|---|
SAPdb_ID | 1537 | |
PMID | 20958029 | |
Year | 2010 | |
Name | FW | |
Sequence | FW | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) and AFM (Atomic force Microscopy) | |
Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water | |
Method | Peptide dissolved in HFIP at a concentration of 100 mg/mL and to dilute the stock solution (FF in HFIP) in methanol at different concentrations, 1-8 mg/mL | |
Concentration | 2-5 mg/ml | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | No | |
Type of Self-Assembly | No assembled structure | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C=O |