Details of SAPdb ID 1535 |
Primary information | ||
---|---|---|
SAPdb_ID | 1535 | |
PMID | 20958029 | |
Year | 2010 | |
Name | FF | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) and AFM (Atomic force Microscopy) | |
Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + Methanol | |
Method | Peptide dissolved in HFIP at a concentration of 100 mg/mL which further diluted to 2mg/ml in DD Water to form self assembled structure | |
Concentration | 2 - 10mg/ml | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | PQD (Peptide quantum dots) | |
Size of Self-Assembled structure | Diameter of 2.12 +/- 0.15 nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |