Welcome to Entry Card of Peptide
Details of SAPdb ID 1500 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1500 | |
| PMID | 19198495 | |
| Year | 2008 | |
| Name | Phe-Phe | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) | |
| Solvent | Methanol | |
| Method | Dipeptide dissolved by sonicating for 20 min, subsequently stirring it with a magnetic bar at 60°C and on cooling to room temperature, nanostructures were formed | |
| Concentration | 10mg/ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanoribbon | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |