Details of SAPdb ID 1455 |
Primary information | ||
---|---|---|
SAPdb_ID | 1455 | |
PMID | 24422499 | |
Year | 2014 | |
Name | DiPhenylalanine | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | Formamide solution | |
Method | Peptide supersaturated solution placed on a glass slide and solutions in various solvents were placed on a glass slide and were left to dry at room temperature. | |
Concentration | 2.6 x 10 -4 M | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 24 - 48 hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Translucent gel | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |