Details of SAPdb ID 1407 |
Primary information | ||
---|---|---|
SAPdb_ID | 1407 | |
PMID | 25229206 | |
Year | 2014 | |
Name | NDI-Phe-Phe or 1 | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Mixture | |
Conjugate Partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Water | |
Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. | |
Concentration | 2% wt | |
pH | 4.8 | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogel | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |