Details of SAPdb ID 1355 |
Primary information | ||
---|---|---|
SAPdb_ID | 1355 | |
PMID | 24036697 | |
Year | 2013 | |
Name | CDP or H–Phe–Phe–NH2. HCl | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | Co-assemble with azobenzed molecule i.e. CPABS (4-[(3-carboxyl-4-hydroxy)phenylazo]benzenesulfonic acid) | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water | |
Method | Peptide added to water and to dissolve peptide in solutioh 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) added. Upon adding aqueous solutions of azobenzenes i.e . CPABS to HFIP solution of CDP (in a 1 : 1 mole ratio) at room temperature, yellow precipitates formed rapidly, indicating generation of co-assembled nanostructures. | |
Concentration | NA | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | Several hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Microsphere | |
Size of Self-Assembled structure | Diameter: 25μm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | Coassembly with Azobenzene | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N |