Details of SAPdb ID 1237 |
Primary information | ||
---|---|---|
SAPdb_ID | 1237 | |
PMID | 20695592 | |
Year | 2010 | |
Name | Dipeptide 2 | |
Sequence | AA | |
N-Terminal Modification | Napthalene | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Conjugate | |
Conjugate Partner | Napthalene | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-Å’Â¥-lactone (GdL) | |
Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. | |
Concentration | 0.5 wt% | |
pH | 3.4 +/- 0.2. | |
Temperature | Room temperature | |
Incubation Period | 24 hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Transparent Gel | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O |