Details of SAPdb ID 1234 |
Primary information | ||
---|---|---|
SAPdb_ID | 1234 | |
PMID | 25198430 | |
Year | 2014 | |
Name | FY | |
Sequence | FY | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | NA | |
Technique | Scanning Electron Microscopy (SEM) | |
Solvent | Methanol + HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) | |
Method | Dipeptide (FY) first dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 100 mg/mL. The corresponding stock solution was then diluted to a final concentration of 1 mg/mL in methanol. | |
Concentration | 1mg/ml | |
pH | NA | |
Temperature | ~64.7 °C | |
Incubation Period | 3 - 20 minutes | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Flower like microstructure | |
Size of Self-Assembled structure | Diameter of wires of microstructre 50 -100nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | Artificial supersaturation caused by Joule heating effect using voltage 100V | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C=O |